C28H30ClN3O3S — CID 142048346
1-[3-[4-(6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-ylidene)piperidin-1-yl]-3-oxopropyl]pyrrole-2,5-dione;methanethiol (PubChem CID 142048346) has the molecular formula C28H30ClN3O3S and a molecular weight of 524.09 g/mol. Its IUPAC name is 1-[3-[4-(6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-ylidene)piperidin-1-yl]-3-oxopropyl]pyrrole-2,5-dione;methanethiol.
| Compound Name | 1-[3-[4-(6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-ylidene)piperidin-1-yl]-3-oxopropyl]pyrrole-2,5-dione;methanethiol |
|---|---|
| PubChem CID | 142048346 |
| Molecular Formula | C28H30ClN3O3S |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 1-[3-[4-(6-chloro-16-azatricyclo[9.5.0.03,8]hexadeca-1(11),3(8),4,6,13,15-hexaen-2-ylidene)piperidin-1-yl]-3-oxopropyl]pyrrole-2,5-dione;methanethiol |
| SMILES | CS.O=C(CCN1C(=O)C=CC1=O)N1CCC(=C2C3=C(CC=CC=N3)CCc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C27H26ClN3O3.CH4S/c28-21-6-7-22-20(17-21)5-4-19-3-1-2-13-29-27(19)26(22)18-10-14-30(15-11-18)23(32)12-16-31-24(33)8-9-25(31)34;1-2/h1-2,6-9,13,17H,3-5,10-12,14-16H2;2H,1H3 |
| InChIKey | ATBPWAZGHLVKIT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|