[(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate

C11H10ClNO2 — CID 76738695

IUPAC[(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate
SMILESCC(=O)ON=C1CCc2cc(Cl)ccc21
InChIInChI=1S/C11H10ClNO2/c1-7(14)15-13-11-5-2-8-6-9(12)3-4-10(8)11/h3-4,6H,2,5H2,1H3
InChIKeyZSKAUMBVEFWUCJ-UHFFFAOYSA-N
MW223.66 g/mol
LogP2.55
Rot. Bonds1

About [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate

[(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate (PubChem CID 76738695) has the molecular formula C11H10ClNO2 and a molecular weight of 223.66 g/mol. Its IUPAC name is [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate.

Molecular Properties

Compound Name[(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate
PubChem CID76738695
Molecular FormulaC11H10ClNO2
Molecular Weight223.66 g/mol
Exact Mass223.04
IUPAC Name[(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate
SMILESCC(=O)ON=C1CCc2cc(Cl)ccc21
InChIInChI=1S/C11H10ClNO2/c1-7(14)15-13-11-5-2-8-6-9(12)3-4-10(8)11/h3-4,6H,2,5H2,1H3
InChIKeyZSKAUMBVEFWUCJ-UHFFFAOYSA-N
XLogP2.55
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.66
LogP ≤ 52.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate?
The IUPAC name of [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate (CID 76738695) is [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate.
What is the SMILES notation for [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate?
The canonical SMILES for [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate is CC(=O)ON=C1CCc2cc(Cl)ccc21.
What is the InChIKey of [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate?
The InChIKey is ZSKAUMBVEFWUCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO2/c1-7(14)15-13-11-5-2-8-6-9(12)3-4-10(8)11/h3-4,6H,2,5H2,1H3.
What are the key properties of [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate?
[(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate has a molecular weight of 223.66 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate is sourced from PubChem (CID 76738695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).