C11H10ClNO2 — CID 76738695
[(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate (PubChem CID 76738695) has the molecular formula C11H10ClNO2 and a molecular weight of 223.66 g/mol. Its IUPAC name is [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate.
| Compound Name | [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate |
|---|---|
| PubChem CID | 76738695 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | [(5-chloro-2,3-dihydroinden-1-ylidene)amino] acetate |
| SMILES | CC(=O)ON=C1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H10ClNO2/c1-7(14)15-13-11-5-2-8-6-9(12)3-4-10(8)11/h3-4,6H,2,5H2,1H3 |
| InChIKey | ZSKAUMBVEFWUCJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|