C16H13ClN2O2 — CID 5404037
[(E)-2,3-dihydroinden-1-ylideneamino] N-(3-chlorophenyl)carbamate (PubChem CID 5404037) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is [(E)-2,3-dihydroinden-1-ylideneamino] N-(3-chlorophenyl)carbamate.
| Compound Name | [(E)-2,3-dihydroinden-1-ylideneamino] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 5404037 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [(E)-2,3-dihydroinden-1-ylideneamino] N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)O/N=C1\CCc2ccccc21 |
| InChI | InChI=1S/C16H13ClN2O2/c17-12-5-3-6-13(10-12)18-16(20)21-19-15-9-8-11-4-1-2-7-14(11)15/h1-7,10H,8-9H2,(H,18,20)/b19-15+ |
| InChIKey | APNBNIRIIASGNZ-XDJHFCHBSA-N |
| XLogP | 4.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|