C16H22ClN3O2 — CID 12523217
[(2,2,6,6-tetramethylpiperidin-4-ylidene)amino] N-(3-chlorophenyl)carbamate (PubChem CID 12523217) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is [(2,2,6,6-tetramethylpiperidin-4-ylidene)amino] N-(3-chlorophenyl)carbamate.
| Compound Name | [(2,2,6,6-tetramethylpiperidin-4-ylidene)amino] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 12523217 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [(2,2,6,6-tetramethylpiperidin-4-ylidene)amino] N-(3-chlorophenyl)carbamate |
| SMILES | CC1(C)CC(=NOC(=O)Nc2cccc(Cl)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-15(2)9-13(10-16(3,4)20-15)19-22-14(21)18-12-7-5-6-11(17)8-12/h5-8,20H,9-10H2,1-4H3,(H,18,21) |
| InChIKey | FRJQYVOLPUEHQX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|