C19H18ClN3O2 — CID 24753086
[(E)-[(2E)-2-(pyridin-2-ylmethylidene)cyclohexylidene]amino] N-(3-chlorophenyl)carbamate (PubChem CID 24753086) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is [(E)-[(2E)-2-(pyridin-2-ylmethylidene)cyclohexylidene]amino] N-(3-chlorophenyl)carbamate.
| Compound Name | [(E)-[(2E)-2-(pyridin-2-ylmethylidene)cyclohexylidene]amino] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 24753086 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [(E)-[(2E)-2-(pyridin-2-ylmethylidene)cyclohexylidene]amino] N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)O/N=C1\CCCC\C1=C/c1ccccn1 |
| InChI | InChI=1S/C19H18ClN3O2/c20-15-7-5-9-17(13-15)22-19(24)25-23-18-10-2-1-6-14(18)12-16-8-3-4-11-21-16/h3-5,7-9,11-13H,1-2,6,10H2,(H,22,24)/b14-12+,23-18+ |
| InChIKey | CXDXNQJPDLROJH-UWKYVTNMSA-N |
| XLogP | 5.30 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|