C11H6Cl3N3O2S — CID 2778820
[(2,4-dichloro-1,3-thiazol-5-yl)methylideneamino] N-(3-chlorophenyl)carbamate (PubChem CID 2778820) has the molecular formula C11H6Cl3N3O2S and a molecular weight of 350.61 g/mol. Its IUPAC name is [(2,4-dichloro-1,3-thiazol-5-yl)methylideneamino] N-(3-chlorophenyl)carbamate.
| Compound Name | [(2,4-dichloro-1,3-thiazol-5-yl)methylideneamino] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 2778820 |
| Molecular Formula | C11H6Cl3N3O2S |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | [(2,4-dichloro-1,3-thiazol-5-yl)methylideneamino] N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)ON=Cc1sc(Cl)nc1Cl |
| InChI | InChI=1S/C11H6Cl3N3O2S/c12-6-2-1-3-7(4-6)16-11(18)19-15-5-8-9(13)17-10(14)20-8/h1-5H,(H,16,18) |
| InChIKey | PQSMQESTQBAUGZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|