C11H8Cl2N2O3 — CID 3769156
[5-(chloromethyl)-1,2-oxazol-3-yl] N-(3-chlorophenyl)carbamate (PubChem CID 3769156) has the molecular formula C11H8Cl2N2O3 and a molecular weight of 287.10 g/mol. Its IUPAC name is [5-(chloromethyl)-1,2-oxazol-3-yl] N-(3-chlorophenyl)carbamate.
| Compound Name | [5-(chloromethyl)-1,2-oxazol-3-yl] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 3769156 |
| Molecular Formula | C11H8Cl2N2O3 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | [5-(chloromethyl)-1,2-oxazol-3-yl] N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)Oc1cc(CCl)on1 |
| InChI | InChI=1S/C11H8Cl2N2O3/c12-6-9-5-10(15-18-9)17-11(16)14-8-3-1-2-7(13)4-8/h1-5H,6H2,(H,14,16) |
| InChIKey | NHXWHMZJQRBCSU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|