C13H8Cl2N4O2S — CID 2799703
[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-(4-chlorophenyl)carbamate (PubChem CID 2799703) has the molecular formula C13H8Cl2N4O2S and a molecular weight of 355.21 g/mol. Its IUPAC name is [(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-(4-chlorophenyl)carbamate.
| Compound Name | [(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 2799703 |
| Molecular Formula | C13H8Cl2N4O2S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | [(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)ON=Cc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C13H8Cl2N4O2S/c14-8-1-3-9(4-2-8)17-13(20)21-16-7-10-11(15)18-12-19(10)5-6-22-12/h1-7H,(H,17,20) |
| InChIKey | JZOHOXZAVYUFKN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|