C19H14N4O2S — CID 1473291
[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-phenylcarbamate (PubChem CID 1473291) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is [(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-phenylcarbamate.
| Compound Name | [(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-phenylcarbamate |
|---|---|
| PubChem CID | 1473291 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)ON=Cc1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C19H14N4O2S/c24-19(21-15-9-5-2-6-10-15)25-20-13-16-17(14-7-3-1-4-8-14)22-18-23(16)11-12-26-18/h1-13H,(H,21,24) |
| InChIKey | WYQDIFZPLWFHMA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|