C17H12N6O3S — CID 6256977
2,4-dioxo-N-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-1H-pyrimidine-6-carboxamide (PubChem CID 6256977) has the molecular formula C17H12N6O3S and a molecular weight of 380.39 g/mol. Its IUPAC name is 2,4-dioxo-N-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-1H-pyrimidine-6-carboxamide.
| Compound Name | 2,4-dioxo-N-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 6256977 |
| Molecular Formula | C17H12N6O3S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2,4-dioxo-N-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(N/N=C\c1c(-c2ccccc2)nc2sccn12)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C17H12N6O3S/c24-13-8-11(19-16(26)20-13)15(25)22-18-9-12-14(10-4-2-1-3-5-10)21-17-23(12)6-7-27-17/h1-9H,(H,22,25)(H2,19,20,24,26)/b18-9- |
| InChIKey | BUGJODOSCZIFBH-NVMNQCDNSA-N |
| XLogP | 1.20 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|