C13H9ClN6O3 — CID 6899895
N-[(E)-(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 6899895) has the molecular formula C13H9ClN6O3 and a molecular weight of 332.71 g/mol. Its IUPAC name is N-[(E)-(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 6899895 |
| Molecular Formula | C13H9ClN6O3 |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-[(E)-(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(N/N=C/c1c(Cl)nc2ccccn12)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H9ClN6O3/c14-11-8(20-4-2-1-3-9(20)17-11)6-15-19-12(22)7-5-10(21)18-13(23)16-7/h1-6H,(H,19,22)(H2,16,18,21,23)/b15-6+ |
| InChIKey | HKGKBLAPVKFLFP-GIDUJCDVSA-N |
| XLogP | 0.13 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|