C14H10ClN5O — CID 2333321
N-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]pyridine-4-carboxamide (PubChem CID 2333321) has the molecular formula C14H10ClN5O and a molecular weight of 299.72 g/mol. Its IUPAC name is N-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2333321 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(NN=Cc1c(Cl)nc2ccccn12)c1ccncc1 |
| InChI | InChI=1S/C14H10ClN5O/c15-13-11(20-8-2-1-3-12(20)18-13)9-17-19-14(21)10-4-6-16-7-5-10/h1-9H,(H,19,21) |
| InChIKey | SNWOLVPTIDFADT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|