C10H8Cl2N2 — CID 79334490
2-chloro-3-(3-chloroprop-1-enyl)imidazo[1,2-a]pyridine (PubChem CID 79334490) has the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. Its IUPAC name is 2-chloro-3-(3-chloroprop-1-enyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-chloro-3-(3-chloroprop-1-enyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 79334490 |
| Molecular Formula | C10H8Cl2N2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-chloro-3-(3-chloroprop-1-enyl)imidazo[1,2-a]pyridine |
| SMILES | ClCC=Cc1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C10H8Cl2N2/c11-6-3-4-8-10(12)13-9-5-1-2-7-14(8)9/h1-5,7H,6H2 |
| InChIKey | DNXNBOVYCTXFOZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|