C20H20ClN3O — CID 98667077
(E)-N-benzyl-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-propan-2-ylprop-2-enamide (PubChem CID 98667077) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is (E)-N-benzyl-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 98667077 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (E)-N-benzyl-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)/C=C/c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C20H20ClN3O/c1-15(2)24(14-16-8-4-3-5-9-16)19(25)12-11-17-20(21)22-18-10-6-7-13-23(17)18/h3-13,15H,14H2,1-2H3/b12-11+ |
| InChIKey | KCTMFGKIMMGFRM-VAWYXSNFSA-N |
| XLogP | 4.44 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|