C19H16BrClN4O2 — CID 26622519
(E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-methylprop-2-enamide (PubChem CID 26622519) has the molecular formula C19H16BrClN4O2 and a molecular weight of 447.72 g/mol. Its IUPAC name is (E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26622519 |
| Molecular Formula | C19H16BrClN4O2 |
| Molecular Weight | 447.72 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | (E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-methylprop-2-enamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)C(=O)/C=C/c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C19H16BrClN4O2/c1-24(12-17(26)22-14-7-3-2-6-13(14)20)18(27)10-9-15-19(21)23-16-8-4-5-11-25(15)16/h2-11H,12H2,1H3,(H,22,26)/b10-9+ |
| InChIKey | BLHBQCFSPJGHIT-MDZDMXLPSA-N |
| XLogP | 3.86 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|