C19H18BrClN2O2 — CID 26622546
(E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(3-chloro-4-methylphenyl)-N-methylprop-2-enamide (PubChem CID 26622546) has the molecular formula C19H18BrClN2O2 and a molecular weight of 421.72 g/mol. Its IUPAC name is (E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(3-chloro-4-methylphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(3-chloro-4-methylphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26622546 |
| Molecular Formula | C19H18BrClN2O2 |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (E)-N-[2-(2-bromoanilino)-2-oxoethyl]-3-(3-chloro-4-methylphenyl)-N-methylprop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(C)CC(=O)Nc2ccccc2Br)cc1Cl |
| InChI | InChI=1S/C19H18BrClN2O2/c1-13-7-8-14(11-16(13)21)9-10-19(25)23(2)12-18(24)22-17-6-4-3-5-15(17)20/h3-11H,12H2,1-2H3,(H,22,24)/b10-9+ |
| InChIKey | DOGCBCJZTDEZFM-MDZDMXLPSA-N |
| XLogP | 4.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|