C20H20ClN3O2 — CID 34864567
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 34864567) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 34864567 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[(4-ethoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CCOc1ccc(CN(C)C(=O)/C=C/c2c(Cl)nc3ccccn23)cc1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-3-26-16-9-7-15(8-10-16)14-23(2)19(25)12-11-17-20(21)22-18-6-4-5-13-24(17)18/h4-13H,3,14H2,1-2H3/b12-11+ |
| InChIKey | FFMOWWIVAGPYBR-VAWYXSNFSA-N |
| XLogP | 4.06 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|