C19H17ClFN3O2 — CID 26994192
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylprop-2-enamide (PubChem CID 26994192) has the molecular formula C19H17ClFN3O2 and a molecular weight of 373.82 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26994192 |
| Molecular Formula | C19H17ClFN3O2 |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylprop-2-enamide |
| SMILES | CN(CCOc1ccc(F)cc1)C(=O)/C=C/c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C19H17ClFN3O2/c1-23(12-13-26-15-7-5-14(21)6-8-15)18(25)10-9-16-19(20)22-17-4-2-3-11-24(16)17/h2-11H,12-13H2,1H3/b10-9+ |
| InChIKey | CLIWKLVCERMBRV-MDZDMXLPSA-N |
| XLogP | 3.68 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|