C20H13Cl2N3O2 — CID 9456507
(2-chloroquinolin-3-yl)methyl (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate (PubChem CID 9456507) has the molecular formula C20H13Cl2N3O2 and a molecular weight of 398.25 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate.
| Compound Name | (2-chloroquinolin-3-yl)methyl (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9456507 |
| Molecular Formula | C20H13Cl2N3O2 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1c(Cl)nc2ccccn12)OCc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C20H13Cl2N3O2/c21-19-14(11-13-5-1-2-6-15(13)23-19)12-27-18(26)9-8-16-20(22)24-17-7-3-4-10-25(16)17/h1-11H,12H2/b9-8+ |
| InChIKey | SACXCUGIWKWWIH-CMDGGOBGSA-N |
| XLogP | 4.95 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|