C15H14ClN3O5 — CID 7734837
[2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate (PubChem CID 7734837) has the molecular formula C15H14ClN3O5 and a molecular weight of 351.75 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7734837 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)/C=C/c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C15H14ClN3O5/c1-2-23-15(22)18-12(20)9-24-13(21)7-6-10-14(16)17-11-5-3-4-8-19(10)11/h3-8H,2,9H2,1H3,(H,18,20,22)/b7-6+ |
| InChIKey | OXXXHOYUDTYQAH-VOTSOKGWSA-N |
| XLogP | 1.82 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|