C20H23ClN4O4 — CID 7735388
[2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate (PubChem CID 7735388) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is [2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate.
| Compound Name | [2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7735388 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)NC(=O)COC(=O)/C=C/c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C20H23ClN4O4/c1-13-6-2-3-7-14(13)22-20(28)24-17(26)12-29-18(27)10-9-15-19(21)23-16-8-4-5-11-25(15)16/h4-5,8-11,13-14H,2-3,6-7,12H2,1H3,(H2,22,24,26,28)/b10-9+/t13-,14-/m0/s1 |
| InChIKey | SACIRTSVFDCHRY-KYXFNPKGSA-N |
| XLogP | 2.95 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|