C21H28N2O5 — CID 7850926
[2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate (PubChem CID 7850926) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7850926 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccccc1/C=C/C(=O)OCC(=O)NC(=O)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C21H28N2O5/c1-3-27-18-11-7-5-9-16(18)12-13-20(25)28-14-19(24)23-21(26)22-17-10-6-4-8-15(17)2/h5,7,9,11-13,15,17H,3-4,6,8,10,14H2,1-2H3,(H2,22,23,24,26)/b13-12+/t15-,17-/m1/s1 |
| InChIKey | RZAVETOSHCUNOV-WFOBCWJPSA-N |
| XLogP | 3.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|