C14H11F3N6S — CID 57395520
2-[(Z)-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine (PubChem CID 57395520) has the molecular formula C14H11F3N6S and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-[(Z)-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine.
| Compound Name | 2-[(Z)-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 57395520 |
| Molecular Formula | C14H11F3N6S |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[(Z)-[6-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C\c1c(-c2cccc(C(F)(F)F)c2)nc2sccn12 |
| InChI | InChI=1S/C14H11F3N6S/c15-14(16,17)9-3-1-2-8(6-9)11-10(7-20-22-12(18)19)23-4-5-24-13(23)21-11/h1-7H,(H4,18,19,22)/b20-7- |
| InChIKey | WTQLRECSUZDYRV-SCDVKCJHSA-N |
| XLogP | 2.69 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|