C13H10ClF3N6S — CID 57399028
2-[(Z)-[6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride (PubChem CID 57399028) has the molecular formula C13H10ClF3N6S and a molecular weight of 374.78 g/mol. Its IUPAC name is 2-[(Z)-[6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(Z)-[6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 57399028 |
| Molecular Formula | C13H10ClF3N6S |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-[(Z)-[6-(2,4,5-trifluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/N=C\c1c(-c2cc(F)c(F)cc2F)nc2sccn12 |
| InChI | InChI=1S/C13H9F3N6S.ClH/c14-7-4-9(16)8(15)3-6(7)11-10(5-19-21-12(17)18)22-1-2-23-13(22)20-11;/h1-5H,(H4,17,18,21);1H/b19-5-; |
| InChIKey | FRCXFJFDSZJBOZ-ZYQHVCNLSA-N |
| XLogP | 2.51 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|