C13H11ClFN7O2S — CID 57397343
2-[(Z)-[2-fluoro-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride (PubChem CID 57397343) has the molecular formula C13H11ClFN7O2S and a molecular weight of 383.80 g/mol. Its IUPAC name is 2-[(Z)-[2-fluoro-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(Z)-[2-fluoro-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 57397343 |
| Molecular Formula | C13H11ClFN7O2S |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-[(Z)-[2-fluoro-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/N=C\c1c(-c2ccc([N+](=O)[O-])cc2)nc2sc(F)cn12 |
| InChI | InChI=1S/C13H10FN7O2S.ClH/c14-10-6-20-9(5-17-19-12(15)16)11(18-13(20)24-10)7-1-3-8(4-2-7)21(22)23;/h1-6H,(H4,15,16,19);1H/b17-5-; |
| InChIKey | XRFCAQDNWHOQQW-PXQSGXIUSA-N |
| XLogP | 2.14 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|