C13H10ClN7O2S — CID 57393798
2-[(E)-[2-chloro-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine (PubChem CID 57393798) has the molecular formula C13H10ClN7O2S and a molecular weight of 363.79 g/mol. Its IUPAC name is 2-[(E)-[2-chloro-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[2-chloro-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 57393798 |
| Molecular Formula | C13H10ClN7O2S |
| Molecular Weight | 363.79 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-[(E)-[2-chloro-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1c(-c2cccc([N+](=O)[O-])c2)nc2sc(Cl)cn12 |
| InChI | InChI=1S/C13H10ClN7O2S/c14-10-6-20-9(5-17-19-12(15)16)11(18-13(20)24-10)7-2-1-3-8(4-7)21(22)23/h1-6H,(H4,15,16,19)/b17-5+ |
| InChIKey | ZUCVGJVUJSOEMH-YAXRCOADSA-N |
| XLogP | 2.23 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.79 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|