C15H11Cl2N3O2S — CID 37345715
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide (PubChem CID 37345715) has the molecular formula C15H11Cl2N3O2S and a molecular weight of 368.25 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 37345715 |
| Molecular Formula | C15H11Cl2N3O2S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(3-chloro-4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2c(Cl)nc3sccn23)cc1Cl |
| InChI | InChI=1S/C15H11Cl2N3O2S/c1-22-12-4-2-9(8-10(12)16)18-13(21)5-3-11-14(17)19-15-20(11)6-7-23-15/h2-8H,1H3,(H,18,21)/b5-3+ |
| InChIKey | QZWXGKUDWSBHKL-HWKANZROSA-N |
| XLogP | 4.36 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|