C18H18ClN3O3S — CID 34728501
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide (PubChem CID 34728501) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 34728501 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)/C=C/c2c(Cl)nc3sccn23)c1 |
| InChI | InChI=1S/C18H18ClN3O3S/c1-3-24-12-5-7-15(25-4-2)13(11-12)20-16(23)8-6-14-17(19)21-18-22(14)9-10-26-18/h5-11H,3-4H2,1-2H3,(H,20,23)/b8-6+ |
| InChIKey | BMDSZOBWVIZSFH-SOFGYWHQSA-N |
| XLogP | 4.50 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|