C19H18ClF3N4OS — CID 2542081
(Z)-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (PubChem CID 2542081) has the molecular formula C19H18ClF3N4OS and a molecular weight of 442.89 g/mol. Its IUPAC name is (Z)-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2542081 |
| Molecular Formula | C19H18ClF3N4OS |
| Molecular Weight | 442.89 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (Z)-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| SMILES | CCCCNc1ccc(C(F)(F)F)cc1NC(=O)/C=C\c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C19H18ClF3N4OS/c1-2-3-8-24-13-5-4-12(19(21,22)23)11-14(13)25-16(28)7-6-15-17(20)26-18-27(15)9-10-29-18/h4-7,9-11,24H,2-3,8H2,1H3,(H,25,28)/b7-6- |
| InChIKey | QYYUBBCGNWCLSQ-SREVYHEPSA-N |
| XLogP | 5.93 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.89 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|