C17H14ClN3O3S — CID 76854583
[2-(4-methylanilino)-2-oxoethyl] 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate (PubChem CID 76854583) has the molecular formula C17H14ClN3O3S and a molecular weight of 375.84 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 76854583 |
| Molecular Formula | C17H14ClN3O3S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C=Cc2c(Cl)nc3sccn23)cc1 |
| InChI | InChI=1S/C17H14ClN3O3S/c1-11-2-4-12(5-3-11)19-14(22)10-24-15(23)7-6-13-16(18)20-17-21(13)8-9-25-17/h2-9H,10H2,1H3,(H,19,22) |
| InChIKey | UDXJKZWFXLOKOX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|