C15H12ClN3O4S2 — CID 60528027
[4-(methanesulfonamido)phenyl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate (PubChem CID 60528027) has the molecular formula C15H12ClN3O4S2 and a molecular weight of 397.87 g/mol. Its IUPAC name is [4-(methanesulfonamido)phenyl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate.
| Compound Name | [4-(methanesulfonamido)phenyl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 60528027 |
| Molecular Formula | C15H12ClN3O4S2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | [4-(methanesulfonamido)phenyl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
| SMILES | CS(=O)(=O)Nc1ccc(OC(=O)/C=C/c2c(Cl)nc3sccn23)cc1 |
| InChI | InChI=1S/C15H12ClN3O4S2/c1-25(21,22)18-10-2-4-11(5-3-10)23-13(20)7-6-12-14(16)17-15-19(12)8-9-24-15/h2-9,18H,1H3/b7-6+ |
| InChIKey | ICIRICDFOOVOFH-VOTSOKGWSA-N |
| XLogP | 3.04 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|