C15H10ClN3O3S — CID 87014064
(3-carbamoylphenyl) (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate (PubChem CID 87014064) has the molecular formula C15H10ClN3O3S and a molecular weight of 347.78 g/mol. Its IUPAC name is (3-carbamoylphenyl) (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate.
| Compound Name | (3-carbamoylphenyl) (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 87014064 |
| Molecular Formula | C15H10ClN3O3S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (3-carbamoylphenyl) (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
| SMILES | NC(=O)c1cccc(OC(=O)/C=C/c2c(Cl)nc3sccn23)c1 |
| InChI | InChI=1S/C15H10ClN3O3S/c16-13-11(19-6-7-23-15(19)18-13)4-5-12(20)22-10-3-1-2-9(8-10)14(17)21/h1-8H,(H2,17,21)/b5-4+ |
| InChIKey | PBOUUYWCYPJEJU-SNAWJCMRSA-N |
| XLogP | 2.77 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|