C11H10ClN3O3S — CID 51916211
[(2R)-1-amino-1-oxopropan-2-yl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate (PubChem CID 51916211) has the molecular formula C11H10ClN3O3S and a molecular weight of 299.74 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 51916211 |
| Molecular Formula | C11H10ClN3O3S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1c(Cl)nc2sccn12)C(N)=O |
| InChI | InChI=1S/C11H10ClN3O3S/c1-6(10(13)17)18-8(16)3-2-7-9(12)14-11-15(7)4-5-19-11/h2-6H,1H3,(H2,13,17)/b3-2+/t6-/m1/s1 |
| InChIKey | IKJVTZVFGZKWRW-YRFDSLTASA-N |
| XLogP | 1.48 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|