C13H13ClN2O3S — CID 2358880
[(2S)-oxolan-2-yl]methyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate (PubChem CID 2358880) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2358880 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H13ClN2O3S/c14-12-10(16-5-7-20-13(16)15-12)3-4-11(17)19-8-9-2-1-6-18-9/h3-5,7,9H,1-2,6,8H2/b4-3+/t9-/m0/s1 |
| InChIKey | FNOLQOBXPAWZID-NWALNABHSA-N |
| XLogP | 2.78 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|