C14H10ClN5O3 — CID 2821570
[[amino(2,1,3-benzoxadiazol-5-yl)methylidene]amino] N-(3-chlorophenyl)carbamate (PubChem CID 2821570) has the molecular formula C14H10ClN5O3 and a molecular weight of 331.72 g/mol. Its IUPAC name is [[amino(2,1,3-benzoxadiazol-5-yl)methylidene]amino] N-(3-chlorophenyl)carbamate.
| Compound Name | [[amino(2,1,3-benzoxadiazol-5-yl)methylidene]amino] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 2821570 |
| Molecular Formula | C14H10ClN5O3 |
| Molecular Weight | 331.72 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | [[amino(2,1,3-benzoxadiazol-5-yl)methylidene]amino] N-(3-chlorophenyl)carbamate |
| SMILES | NC(=NOC(=O)Nc1cccc(Cl)c1)c1ccc2nonc2c1 |
| InChI | InChI=1S/C14H10ClN5O3/c15-9-2-1-3-10(7-9)17-14(21)22-20-13(16)8-4-5-11-12(6-8)19-23-18-11/h1-7H,(H2,16,20)(H,17,21) |
| InChIKey | KTHQAEABMNJULY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|