C18H18ClN3O2 — CID 12604631
[(E)-(1-ethyl-2,3-dihydroquinolin-4-ylidene)amino] N-(4-chlorophenyl)carbamate (PubChem CID 12604631) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is [(E)-(1-ethyl-2,3-dihydroquinolin-4-ylidene)amino] N-(4-chlorophenyl)carbamate.
| Compound Name | [(E)-(1-ethyl-2,3-dihydroquinolin-4-ylidene)amino] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 12604631 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [(E)-(1-ethyl-2,3-dihydroquinolin-4-ylidene)amino] N-(4-chlorophenyl)carbamate |
| SMILES | CCN1CC/C(=N\OC(=O)Nc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H18ClN3O2/c1-2-22-12-11-16(15-5-3-4-6-17(15)22)21-24-18(23)20-14-9-7-13(19)8-10-14/h3-10H,2,11-12H2,1H3,(H,20,23)/b21-16+ |
| InChIKey | ILNGULQNJZVFSX-LTGZKZEYSA-N |
| XLogP | 4.52 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|