C12H13Br2ClN2O2 — CID 23260812
[(Z)-(3,4-dibromo-3-methylbutan-2-ylidene)amino] N-(4-chlorophenyl)carbamate (PubChem CID 23260812) has the molecular formula C12H13Br2ClN2O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is [(Z)-(3,4-dibromo-3-methylbutan-2-ylidene)amino] N-(4-chlorophenyl)carbamate.
| Compound Name | [(Z)-(3,4-dibromo-3-methylbutan-2-ylidene)amino] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 23260812 |
| Molecular Formula | C12H13Br2ClN2O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 409.90 |
| IUPAC Name | [(Z)-(3,4-dibromo-3-methylbutan-2-ylidene)amino] N-(4-chlorophenyl)carbamate |
| SMILES | C/C(=N/OC(=O)Nc1ccc(Cl)cc1)C(C)(Br)CBr |
| InChI | InChI=1S/C12H13Br2ClN2O2/c1-8(12(2,14)7-13)17-19-11(18)16-10-5-3-9(15)4-6-10/h3-6H,7H2,1-2H3,(H,16,18)/b17-8- |
| InChIKey | KKJQARWAUQFGCB-IUXPMGMMSA-N |
| XLogP | 4.81 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|