C14H19ClN4O3 — CID 4888711
[[3-[(4-chlorophenyl)carbamoylamino]-3-methylbutan-2-ylidene]amino] N-methylcarbamate (PubChem CID 4888711) has the molecular formula C14H19ClN4O3 and a molecular weight of 326.78 g/mol. Its IUPAC name is [[3-[(4-chlorophenyl)carbamoylamino]-3-methylbutan-2-ylidene]amino] N-methylcarbamate.
| Compound Name | [[3-[(4-chlorophenyl)carbamoylamino]-3-methylbutan-2-ylidene]amino] N-methylcarbamate |
|---|---|
| PubChem CID | 4888711 |
| Molecular Formula | C14H19ClN4O3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [[3-[(4-chlorophenyl)carbamoylamino]-3-methylbutan-2-ylidene]amino] N-methylcarbamate |
| SMILES | CNC(=O)ON=C(C)C(C)(C)NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN4O3/c1-9(19-22-13(21)16-4)14(2,3)18-12(20)17-11-7-5-10(15)6-8-11/h5-8H,1-4H3,(H,16,21)(H2,17,18,20) |
| InChIKey | HLTQNYJTAMFQQB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|