C20H24Cl2N4O3 — CID 135238973
1-[(1Z)-1-amino-3-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropoxy)iminopropan-2-yl]-3-(4-chlorophenyl)urea (PubChem CID 135238973) has the molecular formula C20H24Cl2N4O3 and a molecular weight of 439.34 g/mol. Its IUPAC name is 1-[(1Z)-1-amino-3-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropoxy)iminopropan-2-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(1Z)-1-amino-3-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropoxy)iminopropan-2-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 135238973 |
| Molecular Formula | C20H24Cl2N4O3 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1-[(1Z)-1-amino-3-(4-chlorophenyl)-1-(2-hydroxy-2-methylpropoxy)iminopropan-2-yl]-3-(4-chlorophenyl)urea |
| SMILES | CC(C)(O)CO/N=C(\N)C(Cc1ccc(Cl)cc1)NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24Cl2N4O3/c1-20(2,28)12-29-26-18(23)17(11-13-3-5-14(21)6-4-13)25-19(27)24-16-9-7-15(22)8-10-16/h3-10,17,28H,11-12H2,1-2H3,(H2,23,26)(H2,24,25,27) |
| InChIKey | RFTHPSILASOFGG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|