C21H22ClFN4O3 — CID 135255243
N-[(2S)-1-amino-3-(4-chlorophenyl)-2-[(4-fluorophenyl)carbamoylamino]propylidene]-1-(hydroxymethyl)cyclopropane-1-carboxamide (PubChem CID 135255243) has the molecular formula C21H22ClFN4O3 and a molecular weight of 432.88 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-(4-chlorophenyl)-2-[(4-fluorophenyl)carbamoylamino]propylidene]-1-(hydroxymethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(2S)-1-amino-3-(4-chlorophenyl)-2-[(4-fluorophenyl)carbamoylamino]propylidene]-1-(hydroxymethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135255243 |
| Molecular Formula | C21H22ClFN4O3 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[(2S)-1-amino-3-(4-chlorophenyl)-2-[(4-fluorophenyl)carbamoylamino]propylidene]-1-(hydroxymethyl)cyclopropane-1-carboxamide |
| SMILES | N/C(=N\C(=O)C1(CO)CC1)[C@H](Cc1ccc(Cl)cc1)NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H22ClFN4O3/c22-14-3-1-13(2-4-14)11-17(18(24)27-19(29)21(12-28)9-10-21)26-20(30)25-16-7-5-15(23)6-8-16/h1-8,17,28H,9-12H2,(H2,24,27,29)(H2,25,26,30)/t17-/m0/s1 |
| InChIKey | RMDYIBWOSLMHPM-KRWDZBQOSA-N |
| XLogP | 2.87 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|