C19H20ClFN4O3 — CID 135238869
N-[1-amino-4-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoylamino]butylidene]-2-hydroxyacetamide (PubChem CID 135238869) has the molecular formula C19H20ClFN4O3 and a molecular weight of 406.85 g/mol. Its IUPAC name is N-[1-amino-4-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoylamino]butylidene]-2-hydroxyacetamide.
| Compound Name | N-[1-amino-4-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoylamino]butylidene]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 135238869 |
| Molecular Formula | C19H20ClFN4O3 |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[1-amino-4-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoylamino]butylidene]-2-hydroxyacetamide |
| SMILES | N/C(CC(Cc1ccc(Cl)cc1)NC(=O)Nc1ccc(F)cc1)=N\C(=O)CO |
| InChI | InChI=1S/C19H20ClFN4O3/c20-13-3-1-12(2-4-13)9-16(10-17(22)25-18(27)11-26)24-19(28)23-15-7-5-14(21)6-8-15/h1-8,16,26H,9-11H2,(H2,22,25,27)(H2,23,24,28) |
| InChIKey | TXMITXGSIAKAKS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|