C26H27ClN2O4 — CID 69435159
tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 69435159) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 69435159 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H27ClN2O4/c1-26(2,3)33-24(30)23(17-18-7-5-4-6-8-18)29-25(31)28-20-11-15-22(16-12-20)32-21-13-9-19(27)10-14-21/h4-16,23H,17H2,1-3H3,(H2,28,29,31)/t23-/m0/s1 |
| InChIKey | GYLYTHIOVSSEIQ-QHCPKHFHSA-N |
| XLogP | 6.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |