C11H10ClN7O4 — CID 1240543
[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino] N-(4-chlorophenyl)carbamate (PubChem CID 1240543) has the molecular formula C11H10ClN7O4 and a molecular weight of 339.70 g/mol. Its IUPAC name is [1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino] N-(4-chlorophenyl)carbamate.
| Compound Name | [1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 1240543 |
| Molecular Formula | C11H10ClN7O4 |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino] N-(4-chlorophenyl)carbamate |
| SMILES | CC(Cn1nnc([N+](=O)[O-])n1)=NOC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10ClN7O4/c1-7(6-18-15-10(14-17-18)19(21)22)16-23-11(20)13-9-4-2-8(12)3-5-9/h2-5H,6H2,1H3,(H,13,20) |
| InChIKey | NFBTUZHKZONFII-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|