C13H15N7O5 — CID 6162750
3,5-dimethoxy-N-[(E)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide (PubChem CID 6162750) has the molecular formula C13H15N7O5 and a molecular weight of 349.31 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(E)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(E)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 6162750 |
| Molecular Formula | C13H15N7O5 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3,5-dimethoxy-N-[(E)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C(\C)Cn2nnc([N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C13H15N7O5/c1-8(7-19-17-13(16-18-19)20(22)23)14-15-12(21)9-4-10(24-2)6-11(5-9)25-3/h4-6H,7H2,1-3H3,(H,15,21)/b14-8+ |
| InChIKey | GEWZHOYTHAVNOQ-RIYZIHGNSA-N |
| XLogP | 0.40 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|