C9H9N7O3S — CID 5091388
N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]thiophene-2-carboxamide (PubChem CID 5091388) has the molecular formula C9H9N7O3S and a molecular weight of 295.28 g/mol. Its IUPAC name is N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 5091388 |
| Molecular Formula | C9H9N7O3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]thiophene-2-carboxamide |
| SMILES | CC(Cn1nnc([N+](=O)[O-])n1)=NNC(=O)c1cccs1 |
| InChI | InChI=1S/C9H9N7O3S/c1-6(5-15-13-9(12-14-15)16(18)19)10-11-8(17)7-3-2-4-20-7/h2-4H,5H2,1H3,(H,11,17) |
| InChIKey | CEAZSGCKWQRGGN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|