C10H10N6O3S — CID 6022354
N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]thiophene-2-carboxamide (PubChem CID 6022354) has the molecular formula C10H10N6O3S and a molecular weight of 294.30 g/mol. Its IUPAC name is N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6022354 |
| Molecular Formula | C10H10N6O3S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]thiophene-2-carboxamide |
| SMILES | C/C(Cn1cnc([N+](=O)[O-])n1)=N\NC(=O)c1cccs1 |
| InChI | InChI=1S/C10H10N6O3S/c1-7(5-15-6-11-10(14-15)16(18)19)12-13-9(17)8-3-2-4-20-8/h2-4,6H,5H2,1H3,(H,13,17)/b12-7+ |
| InChIKey | VRDXARCJEGBELG-KPKJPENVSA-N |
| XLogP | 1.05 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|