C12H11ClN6O4 — CID 5396965
4-chloro-2-hydroxy-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide (PubChem CID 5396965) has the molecular formula C12H11ClN6O4 and a molecular weight of 338.71 g/mol. Its IUPAC name is 4-chloro-2-hydroxy-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide.
| Compound Name | 4-chloro-2-hydroxy-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 5396965 |
| Molecular Formula | C12H11ClN6O4 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-chloro-2-hydroxy-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide |
| SMILES | C/C(Cn1cnc([N+](=O)[O-])n1)=N/NC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H11ClN6O4/c1-7(5-18-6-14-12(17-18)19(22)23)15-16-11(21)9-3-2-8(13)4-10(9)20/h2-4,6,20H,5H2,1H3,(H,16,21)/b15-7- |
| InChIKey | IVTPUDVDDFRKBF-CHHVJCJISA-N |
| XLogP | 1.35 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|