C18H14ClN7O5S — CID 6161256
2-(4-chlorophenyl)sulfanyl-5-nitro-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide (PubChem CID 6161256) has the molecular formula C18H14ClN7O5S and a molecular weight of 475.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-5-nitro-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-5-nitro-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 6161256 |
| Molecular Formula | C18H14ClN7O5S |
| Molecular Weight | 475.87 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-5-nitro-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide |
| SMILES | C/C(Cn1cnc([N+](=O)[O-])n1)=N/NC(=O)c1cc([N+](=O)[O-])ccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN7O5S/c1-11(9-24-10-20-18(23-24)26(30)31)21-22-17(27)15-8-13(25(28)29)4-7-16(15)32-14-5-2-12(19)3-6-14/h2-8,10H,9H2,1H3,(H,22,27)/b21-11- |
| InChIKey | DYXIOKYHJDTUFX-NHDPSOOVSA-N |
| XLogP | 3.70 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|