C24H23ClN4O3S — CID 4876103
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-5-nitro-2-phenylsulfanylbenzamide (PubChem CID 4876103) has the molecular formula C24H23ClN4O3S and a molecular weight of 482.99 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-5-nitro-2-phenylsulfanylbenzamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-5-nitro-2-phenylsulfanylbenzamide |
|---|---|
| PubChem CID | 4876103 |
| Molecular Formula | C24H23ClN4O3S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-5-nitro-2-phenylsulfanylbenzamide |
| SMILES | CN1CCN(c2ccc(Cl)cc2NC(=O)c2cc([N+](=O)[O-])ccc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C24H23ClN4O3S/c1-27-11-13-28(14-12-27)22-9-7-17(25)15-21(22)26-24(30)20-16-18(29(31)32)8-10-23(20)33-19-5-3-2-4-6-19/h2-10,15-16H,11-14H2,1H3,(H,26,30) |
| InChIKey | LSQMIVIBZRNWCS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|