C18H19ClIN3O — CID 26900822
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodobenzamide (PubChem CID 26900822) has the molecular formula C18H19ClIN3O and a molecular weight of 455.73 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodobenzamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 26900822 |
| Molecular Formula | C18H19ClIN3O |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodobenzamide |
| SMILES | CN1CCN(c2ccc(Cl)cc2NC(=O)c2ccccc2I)CC1 |
| InChI | InChI=1S/C18H19ClIN3O/c1-22-8-10-23(11-9-22)17-7-6-13(19)12-16(17)21-18(24)14-4-2-3-5-15(14)20/h2-7,12H,8-11H2,1H3,(H,21,24) |
| InChIKey | UYEYIGAFHBPSBO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|